C13H18N2O2S — CID 79818238
1-(1,3-benzothiazol-2-yl)-3-(2-methoxyethylamino)propan-2-ol (PubChem CID 79818238) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(2-methoxyethylamino)propan-2-ol.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(2-methoxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 79818238 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(2-methoxyethylamino)propan-2-ol |
| SMILES | COCCNCC(O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H18N2O2S/c1-17-7-6-14-9-10(16)8-13-15-11-4-2-3-5-12(11)18-13/h2-5,10,14,16H,6-9H2,1H3 |
| InChIKey | DHYAVMBPUYFQPQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|