C12H16N2OS — CID 64912246
4-(1,3-benzothiazol-2-ylmethylamino)butan-2-ol (PubChem CID 64912246) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylmethylamino)butan-2-ol.
| Compound Name | 4-(1,3-benzothiazol-2-ylmethylamino)butan-2-ol |
|---|---|
| PubChem CID | 64912246 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylmethylamino)butan-2-ol |
| SMILES | CC(O)CCNCc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H16N2OS/c1-9(15)6-7-13-8-12-14-10-4-2-3-5-11(10)16-12/h2-5,9,13,15H,6-8H2,1H3 |
| InChIKey | PGIQPXUWGDJZRY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|