C12H16N2OS — CID 83961861
4-(1,3-benzothiazol-2-ylmethylamino)butan-1-ol (PubChem CID 83961861) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylmethylamino)butan-1-ol.
| Compound Name | 4-(1,3-benzothiazol-2-ylmethylamino)butan-1-ol |
|---|---|
| PubChem CID | 83961861 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylmethylamino)butan-1-ol |
| SMILES | OCCCCNCc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H16N2OS/c15-8-4-3-7-13-9-12-14-10-5-1-2-6-11(10)16-12/h1-2,5-6,13,15H,3-4,7-9H2 |
| InChIKey | SIOZCHWOVOPXQQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|