C13H18N2OS — CID 60672423
N-(1,3-benzothiazol-2-ylmethyl)-3-ethoxypropan-1-amine (PubChem CID 60672423) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-3-ethoxypropan-1-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-3-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 60672423 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-3-ethoxypropan-1-amine |
| SMILES | CCOCCCNCc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H18N2OS/c1-2-16-9-5-8-14-10-13-15-11-6-3-4-7-12(11)17-13/h3-4,6-7,14H,2,5,8-10H2,1H3 |
| InChIKey | ZCZRAXGRZWYWJH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|