C13H19N3OS — CID 105325137
[1-(1,3-benzothiazol-2-yl)-4-ethoxybutan-2-yl]hydrazine (PubChem CID 105325137) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-yl)-4-ethoxybutan-2-yl]hydrazine.
| Compound Name | [1-(1,3-benzothiazol-2-yl)-4-ethoxybutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105325137 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | [1-(1,3-benzothiazol-2-yl)-4-ethoxybutan-2-yl]hydrazine |
| SMILES | CCOCCC(Cc1nc2ccccc2s1)NN |
| InChI | InChI=1S/C13H19N3OS/c1-2-17-8-7-10(16-14)9-13-15-11-5-3-4-6-12(11)18-13/h3-6,10,16H,2,7-9,14H2,1H3 |
| InChIKey | PEFXBXOCFZFZMH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|