C14H21N3S2 — CID 105226468
[1-(1,3-benzothiazol-2-yl)-3-tert-butylsulfanylpropan-2-yl]hydrazine (PubChem CID 105226468) has the molecular formula C14H21N3S2 and a molecular weight of 295.48 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-yl)-3-tert-butylsulfanylpropan-2-yl]hydrazine.
| Compound Name | [1-(1,3-benzothiazol-2-yl)-3-tert-butylsulfanylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105226468 |
| Molecular Formula | C14H21N3S2 |
| Molecular Weight | 295.48 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [1-(1,3-benzothiazol-2-yl)-3-tert-butylsulfanylpropan-2-yl]hydrazine |
| SMILES | CC(C)(C)SCC(Cc1nc2ccccc2s1)NN |
| InChI | InChI=1S/C14H21N3S2/c1-14(2,3)18-9-10(17-15)8-13-16-11-6-4-5-7-12(11)19-13/h4-7,10,17H,8-9,15H2,1-3H3 |
| InChIKey | LIWNDDOATRAGQV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|