C13H19N3S — CID 105245702
1-(1,3-benzothiazol-2-yl)hexan-2-ylhydrazine (PubChem CID 105245702) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)hexan-2-ylhydrazine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)hexan-2-ylhydrazine |
|---|---|
| PubChem CID | 105245702 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)hexan-2-ylhydrazine |
| SMILES | CCCCC(Cc1nc2ccccc2s1)NN |
| InChI | InChI=1S/C13H19N3S/c1-2-3-6-10(16-14)9-13-15-11-7-4-5-8-12(11)17-13/h4-5,7-8,10,16H,2-3,6,9,14H2,1H3 |
| InChIKey | GUHUHYPHOHYMDU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|