C14H16N4S2 — CID 105214676
[1-(1,3-benzothiazol-2-yl)-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine (PubChem CID 105214676) has the molecular formula C14H16N4S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-yl)-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(1,3-benzothiazol-2-yl)-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105214676 |
| Molecular Formula | C14H16N4S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [1-(1,3-benzothiazol-2-yl)-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine |
| SMILES | Cc1nc(CC(Cc2nc3ccccc3s2)NN)cs1 |
| InChI | InChI=1S/C14H16N4S2/c1-9-16-11(8-19-9)6-10(18-15)7-14-17-12-4-2-3-5-13(12)20-14/h2-5,8,10,18H,6-7,15H2,1H3 |
| InChIKey | LKTQVKVOCDSTAF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|