C9H17N3S — CID 105202230
1-(2-methyl-1,3-thiazol-4-yl)pentan-2-ylhydrazine (PubChem CID 105202230) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)pentan-2-ylhydrazine.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)pentan-2-ylhydrazine |
|---|---|
| PubChem CID | 105202230 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)pentan-2-ylhydrazine |
| SMILES | CCCC(Cc1csc(C)n1)NN |
| InChI | InChI=1S/C9H17N3S/c1-3-4-8(12-10)5-9-6-13-7(2)11-9/h6,8,12H,3-5,10H2,1-2H3 |
| InChIKey | JSRFINPFSFYDKB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|