C11H19N3S — CID 105214723
[4-cyclopropyl-1-(2-methyl-1,3-thiazol-4-yl)butan-2-yl]hydrazine (PubChem CID 105214723) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is [4-cyclopropyl-1-(2-methyl-1,3-thiazol-4-yl)butan-2-yl]hydrazine.
| Compound Name | [4-cyclopropyl-1-(2-methyl-1,3-thiazol-4-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105214723 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | [4-cyclopropyl-1-(2-methyl-1,3-thiazol-4-yl)butan-2-yl]hydrazine |
| SMILES | Cc1nc(CC(CCC2CC2)NN)cs1 |
| InChI | InChI=1S/C11H19N3S/c1-8-13-11(7-15-8)6-10(14-12)5-4-9-2-3-9/h7,9-10,14H,2-6,12H2,1H3 |
| InChIKey | XYFVXZJYAYEPGR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|