C13H15F2N3S — CID 105214796
[1-(2,6-difluorophenyl)-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine (PubChem CID 105214796) has the molecular formula C13H15F2N3S and a molecular weight of 283.35 g/mol. Its IUPAC name is [1-(2,6-difluorophenyl)-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(2,6-difluorophenyl)-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105214796 |
| Molecular Formula | C13H15F2N3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [1-(2,6-difluorophenyl)-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine |
| SMILES | Cc1nc(CC(Cc2c(F)cccc2F)NN)cs1 |
| InChI | InChI=1S/C13H15F2N3S/c1-8-17-10(7-19-8)5-9(18-16)6-11-12(14)3-2-4-13(11)15/h2-4,7,9,18H,5-6,16H2,1H3 |
| InChIKey | JGOZIYPQZLAMIO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|