C12H23N3S — CID 105214789
[4-ethyl-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-yl]hydrazine (PubChem CID 105214789) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is [4-ethyl-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-yl]hydrazine.
| Compound Name | [4-ethyl-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105214789 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | [4-ethyl-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-yl]hydrazine |
| SMILES | CCC(CC)CC(Cc1csc(C)n1)NN |
| InChI | InChI=1S/C12H23N3S/c1-4-10(5-2)6-11(15-13)7-12-8-16-9(3)14-12/h8,10-11,15H,4-7,13H2,1-3H3 |
| InChIKey | NVVSUIITHPBHBI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|