C10H19N3S — CID 105214739
[3-methyl-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-yl]hydrazine (PubChem CID 105214739) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is [3-methyl-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-yl]hydrazine.
| Compound Name | [3-methyl-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105214739 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | [3-methyl-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-yl]hydrazine |
| SMILES | CCC(C)C(Cc1csc(C)n1)NN |
| InChI | InChI=1S/C10H19N3S/c1-4-7(2)10(13-11)5-9-6-14-8(3)12-9/h6-7,10,13H,4-5,11H2,1-3H3 |
| InChIKey | CSEOGDFDRFAHQQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|