C16H30N2S — CID 104996994
1-(2-methyl-1,3-thiazol-4-yl)-N,3-dipropylhexan-2-amine (PubChem CID 104996994) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)-N,3-dipropylhexan-2-amine.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)-N,3-dipropylhexan-2-amine |
|---|---|
| PubChem CID | 104996994 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)-N,3-dipropylhexan-2-amine |
| SMILES | CCCNC(Cc1csc(C)n1)C(CCC)CCC |
| InChI | InChI=1S/C16H30N2S/c1-5-8-14(9-6-2)16(17-10-7-3)11-15-12-19-13(4)18-15/h12,14,16-17H,5-11H2,1-4H3 |
| InChIKey | BXZGYNXSSSQXOY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |