C8H14N2S — CID 62798804
1-(2-methyl-1,3-thiazol-4-yl)butan-2-amine (PubChem CID 62798804) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)butan-2-amine.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 62798804 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)butan-2-amine |
| SMILES | CCC(N)Cc1csc(C)n1 |
| InChI | InChI=1S/C8H14N2S/c1-3-7(9)4-8-5-11-6(2)10-8/h5,7H,3-4,9H2,1-2H3 |
| InChIKey | UNSVLVIPMMOLSN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |