C6H10ClNS — CID 141419064
4-ethyl-2-methyl-1,3-thiazole;hydrochloride (PubChem CID 141419064) has the molecular formula C6H10ClNS and a molecular weight of 163.67 g/mol. Its IUPAC name is 4-ethyl-2-methyl-1,3-thiazole;hydrochloride.
| Compound Name | 4-ethyl-2-methyl-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 141419064 |
| Molecular Formula | C6H10ClNS |
| Molecular Weight | 163.67 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | 4-ethyl-2-methyl-1,3-thiazole;hydrochloride |
| SMILES | CCc1csc(C)n1.Cl |
| InChI | InChI=1S/C6H9NS.ClH/c1-3-6-4-8-5(2)7-6;/h4H,3H2,1-2H3;1H |
| InChIKey | VQPZOBPZTGMKHC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.67 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |