C5H8Cl3NS — CID 133061330
4-(chloromethyl)-2-methyl-1,3-thiazole;dihydrochloride (PubChem CID 133061330) has the molecular formula C5H8Cl3NS and a molecular weight of 220.55 g/mol. Its IUPAC name is 4-(chloromethyl)-2-methyl-1,3-thiazole;dihydrochloride.
| Compound Name | 4-(chloromethyl)-2-methyl-1,3-thiazole;dihydrochloride |
|---|---|
| PubChem CID | 133061330 |
| Molecular Formula | C5H8Cl3NS |
| Molecular Weight | 220.55 g/mol |
| Exact Mass | 218.94 |
| IUPAC Name | 4-(chloromethyl)-2-methyl-1,3-thiazole;dihydrochloride |
| SMILES | Cc1nc(CCl)cs1.Cl.Cl |
| InChI | InChI=1S/C5H6ClNS.2ClH/c1-4-7-5(2-6)3-8-4;;/h3H,2H2,1H3;2*1H |
| InChIKey | MOLBTNXWVMIQSU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|