C11H10BrNS — CID 58762168
4-[(4-bromophenyl)methyl]-2-methyl-1,3-thiazole (PubChem CID 58762168) has the molecular formula C11H10BrNS and a molecular weight of 268.18 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[(4-bromophenyl)methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 58762168 |
| Molecular Formula | C11H10BrNS |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | 4-[(4-bromophenyl)methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(Cc2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C11H10BrNS/c1-8-13-11(7-14-8)6-9-2-4-10(12)5-3-9/h2-5,7H,6H2,1H3 |
| InChIKey | OWYQIAOTJKDNDK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |