C10H17ClN2S — CID 79245829
1-chloro-3-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]butan-2-amine (PubChem CID 79245829) has the molecular formula C10H17ClN2S and a molecular weight of 232.78 g/mol. Its IUPAC name is 1-chloro-3-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]butan-2-amine.
| Compound Name | 1-chloro-3-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 79245829 |
| Molecular Formula | C10H17ClN2S |
| Molecular Weight | 232.78 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-chloro-3-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]butan-2-amine |
| SMILES | Cc1nc(CNC(CCl)C(C)C)cs1 |
| InChI | InChI=1S/C10H17ClN2S/c1-7(2)10(4-11)12-5-9-6-14-8(3)13-9/h6-7,10,12H,4-5H2,1-3H3 |
| InChIKey | FTJYHPIQPPEDFC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|