C10H17ClN2S — CID 43532078
4-(chloromethyl)-N,N-dipropyl-1,3-thiazol-2-amine (PubChem CID 43532078) has the molecular formula C10H17ClN2S and a molecular weight of 232.78 g/mol. Its IUPAC name is 4-(chloromethyl)-N,N-dipropyl-1,3-thiazol-2-amine.
| Compound Name | 4-(chloromethyl)-N,N-dipropyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43532078 |
| Molecular Formula | C10H17ClN2S |
| Molecular Weight | 232.78 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-(chloromethyl)-N,N-dipropyl-1,3-thiazol-2-amine |
| SMILES | CCCN(CCC)c1nc(CCl)cs1 |
| InChI | InChI=1S/C10H17ClN2S/c1-3-5-13(6-4-2)10-12-9(7-11)8-14-10/h8H,3-7H2,1-2H3 |
| InChIKey | LJVJNSIHGHXMOA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|