C8H12Cl2N2S — CID 71755793
4-(chloromethyl)-N-cyclopropyl-N-methyl-1,3-thiazol-2-amine;hydrochloride (PubChem CID 71755793) has the molecular formula C8H12Cl2N2S and a molecular weight of 239.17 g/mol. Its IUPAC name is 4-(chloromethyl)-N-cyclopropyl-N-methyl-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | 4-(chloromethyl)-N-cyclopropyl-N-methyl-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71755793 |
| Molecular Formula | C8H12Cl2N2S |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 4-(chloromethyl)-N-cyclopropyl-N-methyl-1,3-thiazol-2-amine;hydrochloride |
| SMILES | CN(c1nc(CCl)cs1)C1CC1.Cl |
| InChI | InChI=1S/C8H11ClN2S.ClH/c1-11(7-2-3-7)8-10-6(4-9)5-12-8;/h5,7H,2-4H2,1H3;1H |
| InChIKey | KVPHISUKTQPYSF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|