C11H19N3O2S — CID 104527466
2-amino-2-[2-(dipropylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 104527466) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-amino-2-[2-(dipropylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-amino-2-[2-(dipropylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 104527466 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-amino-2-[2-(dipropylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCCN(CCC)c1nc(C(N)C(=O)O)cs1 |
| InChI | InChI=1S/C11H19N3O2S/c1-3-5-14(6-4-2)11-13-8(7-17-11)9(12)10(15)16/h7,9H,3-6,12H2,1-2H3,(H,15,16) |
| InChIKey | XVIHDWGBKFDNIS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |