C9H15N3O2S — CID 104527337
2-amino-2-[2-(butan-2-ylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 104527337) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-amino-2-[2-(butan-2-ylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-amino-2-[2-(butan-2-ylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 104527337 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-2-[2-(butan-2-ylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCC(C)Nc1nc(C(N)C(=O)O)cs1 |
| InChI | InChI=1S/C9H15N3O2S/c1-3-5(2)11-9-12-6(4-15-9)7(10)8(13)14/h4-5,7H,3,10H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | ATBKUIBNFRPHFN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |