C13H23N3O2S — CID 104527631
2-amino-2-[2-(octan-2-ylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 104527631) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-amino-2-[2-(octan-2-ylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-amino-2-[2-(octan-2-ylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 104527631 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-amino-2-[2-(octan-2-ylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCCCCCC(C)Nc1nc(C(N)C(=O)O)cs1 |
| InChI | InChI=1S/C13H23N3O2S/c1-3-4-5-6-7-9(2)15-13-16-10(8-19-13)11(14)12(17)18/h8-9,11H,3-7,14H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | AXZINVKZTYSZIQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|