C11H20N2O2S2 — CID 65095510
5-ethylsulfonyl-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-amine (PubChem CID 65095510) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 5-ethylsulfonyl-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-amine.
| Compound Name | 5-ethylsulfonyl-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-amine |
|---|---|
| PubChem CID | 65095510 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-ethylsulfonyl-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-amine |
| SMILES | CCS(=O)(=O)CCCC(N)Cc1csc(C)n1 |
| InChI | InChI=1S/C11H20N2O2S2/c1-3-17(14,15)6-4-5-10(12)7-11-8-16-9(2)13-11/h8,10H,3-7,12H2,1-2H3 |
| InChIKey | PVWZQBAZCVSGGV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |