C15H27NOS — CID 62798439
1-(2-methyl-1,3-thiazol-4-yl)undecan-2-ol (PubChem CID 62798439) has the molecular formula C15H27NOS and a molecular weight of 269.45 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)undecan-2-ol.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)undecan-2-ol |
|---|---|
| PubChem CID | 62798439 |
| Molecular Formula | C15H27NOS |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)undecan-2-ol |
| SMILES | CCCCCCCCCC(O)Cc1csc(C)n1 |
| InChI | InChI=1S/C15H27NOS/c1-3-4-5-6-7-8-9-10-15(17)11-14-12-18-13(2)16-14/h12,15,17H,3-11H2,1-2H3 |
| InChIKey | ZQRJICPHFMDBFX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|