C18H31NOS — CID 63409908
1-(2-methyl-1,3-thiazol-4-yl)tetradecan-2-one (PubChem CID 63409908) has the molecular formula C18H31NOS and a molecular weight of 309.52 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)tetradecan-2-one.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)tetradecan-2-one |
|---|---|
| PubChem CID | 63409908 |
| Molecular Formula | C18H31NOS |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)tetradecan-2-one |
| SMILES | CCCCCCCCCCCCC(=O)Cc1csc(C)n1 |
| InChI | InChI=1S/C18H31NOS/c1-3-4-5-6-7-8-9-10-11-12-13-18(20)14-17-15-21-16(2)19-17/h15H,3-14H2,1-2H3 |
| InChIKey | ILUYJPJCKTZXQK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|