C17H29NOS — CID 115786938
1-(4-tert-butyl-1,3-thiazol-2-yl)decan-2-one (PubChem CID 115786938) has the molecular formula C17H29NOS and a molecular weight of 295.49 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)decan-2-one.
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)decan-2-one |
|---|---|
| PubChem CID | 115786938 |
| Molecular Formula | C17H29NOS |
| Molecular Weight | 295.49 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)decan-2-one |
| SMILES | CCCCCCCCC(=O)Cc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C17H29NOS/c1-5-6-7-8-9-10-11-14(19)12-16-18-15(13-20-16)17(2,3)4/h13H,5-12H2,1-4H3 |
| InChIKey | VCYIRHFFARLMTP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|