C11H18N2OS — CID 116550750
4-amino-1-(4-tert-butyl-1,3-thiazol-2-yl)butan-2-one (PubChem CID 116550750) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 4-amino-1-(4-tert-butyl-1,3-thiazol-2-yl)butan-2-one.
| Compound Name | 4-amino-1-(4-tert-butyl-1,3-thiazol-2-yl)butan-2-one |
|---|---|
| PubChem CID | 116550750 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-amino-1-(4-tert-butyl-1,3-thiazol-2-yl)butan-2-one |
| SMILES | CC(C)(C)c1csc(CC(=O)CCN)n1 |
| InChI | InChI=1S/C11H18N2OS/c1-11(2,3)9-7-15-10(13-9)6-8(14)4-5-12/h7H,4-6,12H2,1-3H3 |
| InChIKey | ICRFUKVVSRKCKD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |