C13H21NO2S — CID 79820419
1-(4-tert-butyl-1,3-thiazol-2-yl)-5-methoxypentan-2-one (PubChem CID 79820419) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)-5-methoxypentan-2-one.
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-5-methoxypentan-2-one |
|---|---|
| PubChem CID | 79820419 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-5-methoxypentan-2-one |
| SMILES | COCCCC(=O)Cc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C13H21NO2S/c1-13(2,3)11-9-17-12(14-11)8-10(15)6-5-7-16-4/h9H,5-8H2,1-4H3 |
| InChIKey | VZSQEDWRTLMFBZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|