C12H22N2S — CID 83161989
6-methyl-1-(2-methyl-1,3-thiazol-4-yl)heptan-2-amine (PubChem CID 83161989) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is 6-methyl-1-(2-methyl-1,3-thiazol-4-yl)heptan-2-amine.
| Compound Name | 6-methyl-1-(2-methyl-1,3-thiazol-4-yl)heptan-2-amine |
|---|---|
| PubChem CID | 83161989 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 6-methyl-1-(2-methyl-1,3-thiazol-4-yl)heptan-2-amine |
| SMILES | Cc1nc(CC(N)CCCC(C)C)cs1 |
| InChI | InChI=1S/C12H22N2S/c1-9(2)5-4-6-11(13)7-12-8-15-10(3)14-12/h8-9,11H,4-7,13H2,1-3H3 |
| InChIKey | NEECMCMLPWFMPH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |