C9H15NO2S — CID 106677820
5-(2-methyl-1,3-thiazol-4-yl)pentane-1,4-diol (PubChem CID 106677820) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 5-(2-methyl-1,3-thiazol-4-yl)pentane-1,4-diol.
| Compound Name | 5-(2-methyl-1,3-thiazol-4-yl)pentane-1,4-diol |
|---|---|
| PubChem CID | 106677820 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 5-(2-methyl-1,3-thiazol-4-yl)pentane-1,4-diol |
| SMILES | Cc1nc(CC(O)CCCO)cs1 |
| InChI | InChI=1S/C9H15NO2S/c1-7-10-8(6-13-7)5-9(12)3-2-4-11/h6,9,11-12H,2-5H2,1H3 |
| InChIKey | BHIDTFHXHSLJMW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |