C10H16N2S — CID 79178263
4-methyl-1-(2-methyl-1,3-thiazol-4-yl)pent-4-en-2-amine (PubChem CID 79178263) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 4-methyl-1-(2-methyl-1,3-thiazol-4-yl)pent-4-en-2-amine.
| Compound Name | 4-methyl-1-(2-methyl-1,3-thiazol-4-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 79178263 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 4-methyl-1-(2-methyl-1,3-thiazol-4-yl)pent-4-en-2-amine |
| SMILES | C=C(C)CC(N)Cc1csc(C)n1 |
| InChI | InChI=1S/C10H16N2S/c1-7(2)4-9(11)5-10-6-13-8(3)12-10/h6,9H,1,4-5,11H2,2-3H3 |
| InChIKey | DMJXTKOSBTWQGL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|