C9H18N4S — CID 105244854
2-hydrazinyl-N,N-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)propan-1-amine (PubChem CID 105244854) has the molecular formula C9H18N4S and a molecular weight of 214.34 g/mol. Its IUPAC name is 2-hydrazinyl-N,N-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)propan-1-amine.
| Compound Name | 2-hydrazinyl-N,N-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 105244854 |
| Molecular Formula | C9H18N4S |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2-hydrazinyl-N,N-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)propan-1-amine |
| SMILES | Cc1nc(CC(CN(C)C)NN)cs1 |
| InChI | InChI=1S/C9H18N4S/c1-7-11-9(6-14-7)4-8(12-10)5-13(2)3/h6,8,12H,4-5,10H2,1-3H3 |
| InChIKey | CXHZVCIFCZILHW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|