C9H12N4S2 — CID 105253862
[2-(2-methyl-1,3-thiazol-4-yl)-1-(1,3-thiazol-5-yl)ethyl]hydrazine (PubChem CID 105253862) has the molecular formula C9H12N4S2 and a molecular weight of 240.36 g/mol. Its IUPAC name is [2-(2-methyl-1,3-thiazol-4-yl)-1-(1,3-thiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(1,3-thiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105253862 |
| Molecular Formula | C9H12N4S2 |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(1,3-thiazol-5-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)c2cncs2)cs1 |
| InChI | InChI=1S/C9H12N4S2/c1-6-12-7(4-14-6)2-8(13-10)9-3-11-5-15-9/h3-5,8,13H,2,10H2,1H3 |
| InChIKey | FKRJICVFGPPOPL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|