C10H14N4S2 — CID 105316113
[2-(2-methyl-1,3-thiazol-4-yl)-1-(4-methyl-1,3-thiazol-5-yl)ethyl]hydrazine (PubChem CID 105316113) has the molecular formula C10H14N4S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is [2-(2-methyl-1,3-thiazol-4-yl)-1-(4-methyl-1,3-thiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(4-methyl-1,3-thiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105316113 |
| Molecular Formula | C10H14N4S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(4-methyl-1,3-thiazol-5-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)c2scnc2C)cs1 |
| InChI | InChI=1S/C10H14N4S2/c1-6-10(16-5-12-6)9(14-11)3-8-4-15-7(2)13-8/h4-5,9,14H,3,11H2,1-2H3 |
| InChIKey | CGRFNPMVGGTSNO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|