C11H15N3S2 — CID 105251888
[2-(2-methyl-1,3-thiazol-4-yl)-1-(4-methylthiophen-3-yl)ethyl]hydrazine (PubChem CID 105251888) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is [2-(2-methyl-1,3-thiazol-4-yl)-1-(4-methylthiophen-3-yl)ethyl]hydrazine.
| Compound Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(4-methylthiophen-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105251888 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(4-methylthiophen-3-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)c2cscc2C)cs1 |
| InChI | InChI=1S/C11H15N3S2/c1-7-4-15-6-10(7)11(14-12)3-9-5-16-8(2)13-9/h4-6,11,14H,3,12H2,1-2H3 |
| InChIKey | HOOJLOVHRLQAJB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|