C13H19N3OS — CID 105316117
[2-(2-methyl-1,3-thiazol-4-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine (PubChem CID 105316117) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is [2-(2-methyl-1,3-thiazol-4-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine.
| Compound Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105316117 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)c2c(C)oc(C)c2C)cs1 |
| InChI | InChI=1S/C13H19N3OS/c1-7-8(2)17-9(3)13(7)12(16-14)5-11-6-18-10(4)15-11/h6,12,16H,5,14H2,1-4H3 |
| InChIKey | JBIPJVOCJRMFTF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|