C14H21N3OS — CID 105326755
[2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine (PubChem CID 105326755) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is [2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105326755 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | [2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)c2c(C)oc(C)c2C)sc1C |
| InChI | InChI=1S/C14H21N3OS/c1-7-9(3)18-10(4)14(7)12(17-15)6-13-16-8(2)11(5)19-13/h12,17H,6,15H2,1-5H3 |
| InChIKey | PXDUSKYBDITIML-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|