C13H16BrN3S — CID 105192292
[1-(4-bromophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105192292) has the molecular formula C13H16BrN3S and a molecular weight of 326.26 g/mol. Its IUPAC name is [1-(4-bromophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(4-bromophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105192292 |
| Molecular Formula | C13H16BrN3S |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | [1-(4-bromophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)c2ccc(Br)cc2)sc1C |
| InChI | InChI=1S/C13H16BrN3S/c1-8-9(2)18-13(16-8)7-12(17-15)10-3-5-11(14)6-4-10/h3-6,12,17H,7,15H2,1-2H3 |
| InChIKey | DDGHXKIMKIESQK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|