C11H17N3OS — CID 102649950
[1-(3,4-dihydro-2H-pyran-6-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine (PubChem CID 102649950) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-6-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-pyran-6-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102649950 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-6-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)C2=CCCCO2)cs1 |
| InChI | InChI=1S/C11H17N3OS/c1-8-13-9(7-16-8)6-10(14-12)11-4-2-3-5-15-11/h4,7,10,14H,2-3,5-6,12H2,1H3 |
| InChIKey | CHODEQSDYHNUMB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|