C15H21N3OS — CID 105214788
[2-(2-methyl-1,3-thiazol-4-yl)-1-(4-propan-2-yloxyphenyl)ethyl]hydrazine (PubChem CID 105214788) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is [2-(2-methyl-1,3-thiazol-4-yl)-1-(4-propan-2-yloxyphenyl)ethyl]hydrazine.
| Compound Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(4-propan-2-yloxyphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105214788 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(4-propan-2-yloxyphenyl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)c2ccc(OC(C)C)cc2)cs1 |
| InChI | InChI=1S/C15H21N3OS/c1-10(2)19-14-6-4-12(5-7-14)15(18-16)8-13-9-20-11(3)17-13/h4-7,9-10,15,18H,8,16H2,1-3H3 |
| InChIKey | YQYNQSLWTSRYDG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|