C13H13F4N3S — CID 105316164
[1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine (PubChem CID 105316164) has the molecular formula C13H13F4N3S and a molecular weight of 319.33 g/mol. Its IUPAC name is [1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine.
| Compound Name | [1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105316164 |
| Molecular Formula | C13H13F4N3S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | [1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)c2ccc(F)c(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C13H13F4N3S/c1-7-19-9(6-21-7)5-12(20-18)8-2-3-11(14)10(4-8)13(15,16)17/h2-4,6,12,20H,5,18H2,1H3 |
| InChIKey | VJNMNSRTHBENCK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|