C12H15N5S2 — CID 105214580
[1-imidazo[2,1-b][1,3]thiazol-6-yl-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine (PubChem CID 105214580) has the molecular formula C12H15N5S2 and a molecular weight of 293.42 g/mol. Its IUPAC name is [1-imidazo[2,1-b][1,3]thiazol-6-yl-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine.
| Compound Name | [1-imidazo[2,1-b][1,3]thiazol-6-yl-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105214580 |
| Molecular Formula | C12H15N5S2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | [1-imidazo[2,1-b][1,3]thiazol-6-yl-3-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]hydrazine |
| SMILES | Cc1nc(CC(Cc2cn3ccsc3n2)NN)cs1 |
| InChI | InChI=1S/C12H15N5S2/c1-8-14-11(7-19-8)5-9(16-13)4-10-6-17-2-3-18-12(17)15-10/h2-3,6-7,9,16H,4-5,13H2,1H3 |
| InChIKey | MDHJGTFFYJDLAZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|