C10H16N4OS — CID 105235209
(1-ethoxy-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-yl)hydrazine (PubChem CID 105235209) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is (1-ethoxy-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-yl)hydrazine.
| Compound Name | (1-ethoxy-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105235209 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (1-ethoxy-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-yl)hydrazine |
| SMILES | CCOCC(Cc1cn2ccsc2n1)NN |
| InChI | InChI=1S/C10H16N4OS/c1-2-15-7-9(13-11)5-8-6-14-3-4-16-10(14)12-8/h3-4,6,9,13H,2,5,7,11H2,1H3 |
| InChIKey | IINXNCLFLGHEIN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|