C11H12N6S — CID 105203575
(2-imidazo[2,1-b][1,3]thiazol-6-yl-1-pyrimidin-2-ylethyl)hydrazine (PubChem CID 105203575) has the molecular formula C11H12N6S and a molecular weight of 260.33 g/mol. Its IUPAC name is (2-imidazo[2,1-b][1,3]thiazol-6-yl-1-pyrimidin-2-ylethyl)hydrazine.
| Compound Name | (2-imidazo[2,1-b][1,3]thiazol-6-yl-1-pyrimidin-2-ylethyl)hydrazine |
|---|---|
| PubChem CID | 105203575 |
| Molecular Formula | C11H12N6S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (2-imidazo[2,1-b][1,3]thiazol-6-yl-1-pyrimidin-2-ylethyl)hydrazine |
| SMILES | NNC(Cc1cn2ccsc2n1)c1ncccn1 |
| InChI | InChI=1S/C11H12N6S/c12-16-9(10-13-2-1-3-14-10)6-8-7-17-4-5-18-11(17)15-8/h1-5,7,9,16H,6,12H2 |
| InChIKey | MMOSCPHPMRFTRV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|