C12H14N6OS — CID 103375547
[2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(6-methoxypyridazin-3-yl)ethyl]hydrazine (PubChem CID 103375547) has the molecular formula C12H14N6OS and a molecular weight of 290.35 g/mol. Its IUPAC name is [2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(6-methoxypyridazin-3-yl)ethyl]hydrazine.
| Compound Name | [2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(6-methoxypyridazin-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 103375547 |
| Molecular Formula | C12H14N6OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(6-methoxypyridazin-3-yl)ethyl]hydrazine |
| SMILES | COc1ccc(C(Cc2cn3ccsc3n2)NN)nn1 |
| InChI | InChI=1S/C12H14N6OS/c1-19-11-3-2-9(16-17-11)10(15-13)6-8-7-18-4-5-20-12(18)14-8/h2-5,7,10,15H,6,13H2,1H3 |
| InChIKey | CYKFUARVGOLHQQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|