C14H15FN4S — CID 105211512
[1-(5-fluoro-2-methylphenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine (PubChem CID 105211512) has the molecular formula C14H15FN4S and a molecular weight of 290.37 g/mol. Its IUPAC name is [1-(5-fluoro-2-methylphenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine.
| Compound Name | [1-(5-fluoro-2-methylphenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105211512 |
| Molecular Formula | C14H15FN4S |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [1-(5-fluoro-2-methylphenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
| SMILES | Cc1ccc(F)cc1C(Cc1cn2ccsc2n1)NN |
| InChI | InChI=1S/C14H15FN4S/c1-9-2-3-10(15)6-12(9)13(18-16)7-11-8-19-4-5-20-14(19)17-11/h2-6,8,13,18H,7,16H2,1H3 |
| InChIKey | XNWHUFBZRMDPMS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|