C12H12FN5S — CID 105258531
[1-(3-fluoro-4-pyridinyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine (PubChem CID 105258531) has the molecular formula C12H12FN5S and a molecular weight of 277.33 g/mol. Its IUPAC name is [1-(3-fluoro-4-pyridinyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine.
| Compound Name | [1-(3-fluoro-4-pyridinyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105258531 |
| Molecular Formula | C12H12FN5S |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | [1-(3-fluoro-4-pyridinyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
| SMILES | NNC(Cc1cn2ccsc2n1)c1ccncc1F |
| InChI | InChI=1S/C12H12FN5S/c13-10-6-15-2-1-9(10)11(17-14)5-8-7-18-3-4-19-12(18)16-8/h1-4,6-7,11,17H,5,14H2 |
| InChIKey | HRVXEYQOTWSZGM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|