C13H12Br2N4S — CID 107979339
[1-(3,5-dibromophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine (PubChem CID 107979339) has the molecular formula C13H12Br2N4S and a molecular weight of 416.14 g/mol. Its IUPAC name is [1-(3,5-dibromophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine.
| Compound Name | [1-(3,5-dibromophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
|---|---|
| PubChem CID | 107979339 |
| Molecular Formula | C13H12Br2N4S |
| Molecular Weight | 416.14 g/mol |
| Exact Mass | 413.91 |
| IUPAC Name | [1-(3,5-dibromophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
| SMILES | NNC(Cc1cn2ccsc2n1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H12Br2N4S/c14-9-3-8(4-10(15)5-9)12(18-16)6-11-7-19-1-2-20-13(19)17-11/h1-5,7,12,18H,6,16H2 |
| InChIKey | WDAMRMFTUPBHSA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|